C15H15N5O2S — CID 71853089
2-[1-(1,3-dimethyl-4-nitropyrazol-5-yl)azetidin-3-yl]-1,3-benzothiazole (PubChem CID 71853089) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-[1-(1,3-dimethyl-4-nitropyrazol-5-yl)azetidin-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(1,3-dimethyl-4-nitropyrazol-5-yl)azetidin-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 71853089 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[1-(1,3-dimethyl-4-nitropyrazol-5-yl)azetidin-3-yl]-1,3-benzothiazole |
| SMILES | Cc1nn(C)c(N2CC(c3nc4ccccc4s3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N5O2S/c1-9-13(20(21)22)15(18(2)17-9)19-7-10(8-19)14-16-11-5-3-4-6-12(11)23-14/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | OCSLJZULGSXDGD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|