C20H22N4O2S — CID 134016033
1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione (PubChem CID 134016033) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 134016033 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C20H22N4O2S/c1-12-17(13(2)23(3)22-12)18(25)20(26)24-10-8-14(9-11-24)19-21-15-6-4-5-7-16(15)27-19/h4-7,14H,8-11H2,1-3H3 |
| InChIKey | KGJKLMLCOPUPFP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|