C15H17ClFN5O4S — CID 55832766
1-(3-chloro-4-fluorophenyl)sulfonyl-4-(1,3-dimethyl-4-nitropyrazol-5-yl)piperazine (PubChem CID 55832766) has the molecular formula C15H17ClFN5O4S and a molecular weight of 417.85 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-4-(1,3-dimethyl-4-nitropyrazol-5-yl)piperazine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-(1,3-dimethyl-4-nitropyrazol-5-yl)piperazine |
|---|---|
| PubChem CID | 55832766 |
| Molecular Formula | C15H17ClFN5O4S |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-4-(1,3-dimethyl-4-nitropyrazol-5-yl)piperazine |
| SMILES | Cc1nn(C)c(N2CCN(S(=O)(=O)c3ccc(F)c(Cl)c3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17ClFN5O4S/c1-10-14(22(23)24)15(19(2)18-10)20-5-7-21(8-6-20)27(25,26)11-3-4-13(17)12(16)9-11/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | IHJFYIOARGWNCW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|