C16H17ClF2N4O2S — CID 133416420
4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-6-ethyl-5-fluoropyrimidine (PubChem CID 133416420) has the molecular formula C16H17ClF2N4O2S and a molecular weight of 402.85 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-6-ethyl-5-fluoropyrimidine.
| Compound Name | 4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-6-ethyl-5-fluoropyrimidine |
|---|---|
| PubChem CID | 133416420 |
| Molecular Formula | C16H17ClF2N4O2S |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-6-ethyl-5-fluoropyrimidine |
| SMILES | CCc1ncnc(N2CCN(S(=O)(=O)c3ccc(F)c(Cl)c3)CC2)c1F |
| InChI | InChI=1S/C16H17ClF2N4O2S/c1-2-14-15(19)16(21-10-20-14)22-5-7-23(8-6-22)26(24,25)11-3-4-13(18)12(17)9-11/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | PJVUOOYBRGLLIK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |