C17H21ClFN5O2S — CID 122351823
6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-N-ethyl-2-methylpyrimidin-4-amine (PubChem CID 122351823) has the molecular formula C17H21ClFN5O2S and a molecular weight of 413.91 g/mol. Its IUPAC name is 6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-N-ethyl-2-methylpyrimidin-4-amine.
| Compound Name | 6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-N-ethyl-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122351823 |
| Molecular Formula | C17H21ClFN5O2S |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-N-ethyl-2-methylpyrimidin-4-amine |
| SMILES | CCNc1cc(N2CCN(S(=O)(=O)c3ccc(F)c(Cl)c3)CC2)nc(C)n1 |
| InChI | InChI=1S/C17H21ClFN5O2S/c1-3-20-16-11-17(22-12(2)21-16)23-6-8-24(9-7-23)27(25,26)13-4-5-15(19)14(18)10-13/h4-5,10-11H,3,6-9H2,1-2H3,(H,20,21,22) |
| InChIKey | KBDMXLUSNPPKFO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |