C18H24FN5O2S — CID 122351832
N-ethyl-6-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-methylpyrimidin-4-amine (PubChem CID 122351832) has the molecular formula C18H24FN5O2S and a molecular weight of 393.49 g/mol. Its IUPAC name is N-ethyl-6-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-methylpyrimidin-4-amine.
| Compound Name | N-ethyl-6-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122351832 |
| Molecular Formula | C18H24FN5O2S |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-ethyl-6-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-methylpyrimidin-4-amine |
| SMILES | CCNc1cc(N2CCN(S(=O)(=O)Cc3ccc(F)cc3)CC2)nc(C)n1 |
| InChI | InChI=1S/C18H24FN5O2S/c1-3-20-17-12-18(22-14(2)21-17)23-8-10-24(11-9-23)27(25,26)13-15-4-6-16(19)7-5-15/h4-7,12H,3,8-11,13H2,1-2H3,(H,20,21,22) |
| InChIKey | NIHQULFVIKBCAH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |