C20H24N6O2S — CID 122337886
2-methyl-4-[4-[(4-methylphenyl)methylsulfonyl]piperazin-1-yl]-6-pyrazol-1-ylpyrimidine (PubChem CID 122337886) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-methyl-4-[4-[(4-methylphenyl)methylsulfonyl]piperazin-1-yl]-6-pyrazol-1-ylpyrimidine.
| Compound Name | 2-methyl-4-[4-[(4-methylphenyl)methylsulfonyl]piperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 122337886 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-methyl-4-[4-[(4-methylphenyl)methylsulfonyl]piperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCN(c3cc(-n4cccn4)nc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C20H24N6O2S/c1-16-4-6-18(7-5-16)15-29(27,28)25-12-10-24(11-13-25)19-14-20(23-17(2)22-19)26-9-3-8-21-26/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | YBVFKTWALVSECW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |