C13H18N6O2S — CID 121072523
2-methyl-4-(4-methylsulfonylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine (PubChem CID 121072523) has the molecular formula C13H18N6O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-methyl-4-(4-methylsulfonylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine.
| Compound Name | 2-methyl-4-(4-methylsulfonylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 121072523 |
| Molecular Formula | C13H18N6O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-methyl-4-(4-methylsulfonylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine |
| SMILES | Cc1nc(N2CCN(S(C)(=O)=O)CC2)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H18N6O2S/c1-11-15-12(10-13(16-11)19-5-3-4-14-19)17-6-8-18(9-7-17)22(2,20)21/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | DHEXZJBJMMIDFW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |