C19H21ClN6O2S — CID 122337856
4-[4-(3-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine (PubChem CID 122337856) has the molecular formula C19H21ClN6O2S and a molecular weight of 432.94 g/mol. Its IUPAC name is 4-[4-(3-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine.
| Compound Name | 4-[4-(3-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 122337856 |
| Molecular Formula | C19H21ClN6O2S |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 4-[4-(3-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-pyrazol-1-ylpyrimidine |
| SMILES | Cc1nc(N2CCN(S(=O)(=O)c3cccc(Cl)c3C)CC2)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C19H21ClN6O2S/c1-14-16(20)5-3-6-17(14)29(27,28)25-11-9-24(10-12-25)18-13-19(23-15(2)22-18)26-8-4-7-21-26/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | SDTOEKWKRMJKEC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |