C16H13Cl2FN4O2S — CID 56584208
3-chloro-6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carbonitrile (PubChem CID 56584208) has the molecular formula C16H13Cl2FN4O2S and a molecular weight of 415.28 g/mol. Its IUPAC name is 3-chloro-6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 56584208 |
| Molecular Formula | C16H13Cl2FN4O2S |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 3-chloro-6-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(N2CCN(S(=O)(=O)c3ccc(F)c(Cl)c3)CC2)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2FN4O2S/c17-12-2-4-16(21-15(12)10-20)22-5-7-23(8-6-22)26(24,25)11-1-3-14(19)13(18)9-11/h1-4,9H,5-8H2 |
| InChIKey | OQWJLQWLBRVBJC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |