C19H23ClFN5O2S — CID 122344247
4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-2-piperidin-1-ylpyrimidine (PubChem CID 122344247) has the molecular formula C19H23ClFN5O2S and a molecular weight of 439.94 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-2-piperidin-1-ylpyrimidine.
| Compound Name | 4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-2-piperidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 122344247 |
| Molecular Formula | C19H23ClFN5O2S |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-2-piperidin-1-ylpyrimidine |
| SMILES | O=S(=O)(c1ccc(F)c(Cl)c1)N1CCN(c2ccnc(N3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C19H23ClFN5O2S/c20-16-14-15(4-5-17(16)21)29(27,28)26-12-10-24(11-13-26)18-6-7-22-19(23-18)25-8-2-1-3-9-25/h4-7,14H,1-3,8-13H2 |
| InChIKey | YTQWITJXEFRFAJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |