C18H22ClFN4O — CID 138996774
2-(4-chlorophenyl)-2-[4-(6-ethyl-5-fluoropyrimidin-4-yl)piperazin-1-yl]ethanol (PubChem CID 138996774) has the molecular formula C18H22ClFN4O and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[4-(6-ethyl-5-fluoropyrimidin-4-yl)piperazin-1-yl]ethanol.
| Compound Name | 2-(4-chlorophenyl)-2-[4-(6-ethyl-5-fluoropyrimidin-4-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 138996774 |
| Molecular Formula | C18H22ClFN4O |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[4-(6-ethyl-5-fluoropyrimidin-4-yl)piperazin-1-yl]ethanol |
| SMILES | CCc1ncnc(N2CCN(C(CO)c3ccc(Cl)cc3)CC2)c1F |
| InChI | InChI=1S/C18H22ClFN4O/c1-2-15-17(20)18(22-12-21-15)24-9-7-23(8-10-24)16(11-25)13-3-5-14(19)6-4-13/h3-6,12,16,25H,2,7-11H2,1H3 |
| InChIKey | HOTAERVAWUXWIP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |