C11H19N5O4S — CID 136580781
(2S)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-methyl-1-methylsulfonylpiperazine (PubChem CID 136580781) has the molecular formula C11H19N5O4S and a molecular weight of 317.37 g/mol. Its IUPAC name is (2S)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-methyl-1-methylsulfonylpiperazine.
| Compound Name | (2S)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-methyl-1-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 136580781 |
| Molecular Formula | C11H19N5O4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (2S)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-methyl-1-methylsulfonylpiperazine |
| SMILES | Cc1nn(C)c(N2CCN(S(C)(=O)=O)[C@@H](C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N5O4S/c1-8-7-14(5-6-15(8)21(4,19)20)11-10(16(17)18)9(2)12-13(11)3/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | MCEWPHLKFHIWHA-QMMMGPOBSA-N |
| XLogP | 0.11 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|