C14H21N7O3 — CID 119040093
4-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-2-(4-ethyl-1,2,4-triazol-3-yl)morpholine (PubChem CID 119040093) has the molecular formula C14H21N7O3 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-2-(4-ethyl-1,2,4-triazol-3-yl)morpholine.
| Compound Name | 4-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-2-(4-ethyl-1,2,4-triazol-3-yl)morpholine |
|---|---|
| PubChem CID | 119040093 |
| Molecular Formula | C14H21N7O3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-2-(4-ethyl-1,2,4-triazol-3-yl)morpholine |
| SMILES | CCn1cnnc1C1CN(c2c([N+](=O)[O-])c(C)nn2CC)CCO1 |
| InChI | InChI=1S/C14H21N7O3/c1-4-18-9-15-16-13(18)11-8-19(6-7-24-11)14-12(21(22)23)10(3)17-20(14)5-2/h9,11H,4-8H2,1-3H3 |
| InChIKey | YGNPOSNVZOSIIF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|