C25H24Cl2N6O4 — CID 87320161
5-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylpyrimidine (PubChem CID 87320161) has the molecular formula C25H24Cl2N6O4 and a molecular weight of 543.41 g/mol. Its IUPAC name is 5-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylpyrimidine.
| Compound Name | 5-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 87320161 |
| Molecular Formula | C25H24Cl2N6O4 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 5-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylpyrimidine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cnc(N3CCCCC3)nc2)ccc1Cl |
| InChI | InChI=1S/C25H24Cl2N6O4/c26-19-6-4-16(12-23(19)32(34)35)21-8-9-22(17-5-7-20(27)24(13-17)33(36)37)31(21)18-14-28-25(29-15-18)30-10-2-1-3-11-30/h4-7,12-15,21-22H,1-3,8-11H2/t21-,22-/m1/s1 |
| InChIKey | OEJKPJARWCZTLY-FGZHOGPDSA-N |
| XLogP | 6.67 |
| TPSA | 118.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|