C31H27Cl2N5O5 — CID 91371664
4-[5-[3-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]-2-pyridinyl]morpholine (PubChem CID 91371664) has the molecular formula C31H27Cl2N5O5 and a molecular weight of 620.49 g/mol. Its IUPAC name is 4-[5-[3-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]-2-pyridinyl]morpholine.
| Compound Name | 4-[5-[3-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 91371664 |
| Molecular Formula | C31H27Cl2N5O5 |
| Molecular Weight | 620.49 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | 4-[5-[3-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]-2-pyridinyl]morpholine |
| SMILES | O=[N+]([O-])c1cc(C2CCC(c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cccc(-c3ccc(N4CCOCC4)nc3)c2)ccc1Cl |
| InChI | InChI=1S/C31H27Cl2N5O5/c32-25-7-4-21(17-29(25)37(39)40)27-9-10-28(22-5-8-26(33)30(18-22)38(41)42)36(27)24-3-1-2-20(16-24)23-6-11-31(34-19-23)35-12-14-43-15-13-35/h1-8,11,16-19,27-28H,9-10,12-15H2 |
| InChIKey | LFSLKEZKKUVRBE-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.49 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|