C31H33N5O — CID 67236705
4-[5-(4-aminophenyl)-1-[4-(6-morpholin-4-yl-3-pyridinyl)phenyl]pyrrolidin-2-yl]aniline (PubChem CID 67236705) has the molecular formula C31H33N5O and a molecular weight of 491.64 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)-1-[4-(6-morpholin-4-yl-3-pyridinyl)phenyl]pyrrolidin-2-yl]aniline.
| Compound Name | 4-[5-(4-aminophenyl)-1-[4-(6-morpholin-4-yl-3-pyridinyl)phenyl]pyrrolidin-2-yl]aniline |
|---|---|
| PubChem CID | 67236705 |
| Molecular Formula | C31H33N5O |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 4-[5-(4-aminophenyl)-1-[4-(6-morpholin-4-yl-3-pyridinyl)phenyl]pyrrolidin-2-yl]aniline |
| SMILES | Nc1ccc(C2CCC(c3ccc(N)cc3)N2c2ccc(-c3ccc(N4CCOCC4)nc3)cc2)cc1 |
| InChI | InChI=1S/C31H33N5O/c32-26-8-1-23(2-9-26)29-14-15-30(24-3-10-27(33)11-4-24)36(29)28-12-5-22(6-13-28)25-7-16-31(34-21-25)35-17-19-37-20-18-35/h1-13,16,21,29-30H,14-15,17-20,32-33H2 |
| InChIKey | CWDZYVOHGRCCEK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|