C28H28Cl2N4O4 — CID 87082807
1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-methylphenyl]piperidine (PubChem CID 87082807) has the molecular formula C28H28Cl2N4O4 and a molecular weight of 555.46 g/mol. Its IUPAC name is 1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-methylphenyl]piperidine.
| Compound Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-methylphenyl]piperidine |
|---|---|
| PubChem CID | 87082807 |
| Molecular Formula | C28H28Cl2N4O4 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-methylphenyl]piperidine |
| SMILES | Cc1cc(N2[C@@H](c3ccc(Cl)c([N+](=O)[O-])c3)CC[C@@H]2c2ccc(Cl)c([N+](=O)[O-])c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C28H28Cl2N4O4/c1-18-15-21(7-10-24(18)31-13-3-2-4-14-31)32-25(19-5-8-22(29)27(16-19)33(35)36)11-12-26(32)20-6-9-23(30)28(17-20)34(37)38/h5-10,15-17,25-26H,2-4,11-14H2,1H3/t25-,26-/m1/s1 |
| InChIKey | SCALMVVGNZHXFI-CLJLJLNGSA-N |
| XLogP | 8.19 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|