C31H30Cl2F4N4O4 — CID 123275360
1-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-tert-butylpiperidine (PubChem CID 123275360) has the molecular formula C31H30Cl2F4N4O4 and a molecular weight of 669.50 g/mol. Its IUPAC name is 1-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-tert-butylpiperidine.
| Compound Name | 1-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-tert-butylpiperidine |
|---|---|
| PubChem CID | 123275360 |
| Molecular Formula | C31H30Cl2F4N4O4 |
| Molecular Weight | 669.50 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 1-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-tert-butylpiperidine |
| SMILES | CC(C)(C)C1CCN(c2c(F)cc(N3C(c4cc([N+](=O)[O-])c(Cl)cc4F)CCC3c3cc([N+](=O)[O-])c(Cl)cc3F)cc2F)CC1 |
| InChI | InChI=1S/C31H30Cl2F4N4O4/c1-31(2,3)16-6-8-38(9-7-16)30-24(36)10-17(11-25(30)37)39-26(18-12-28(40(42)43)20(32)14-22(18)34)4-5-27(39)19-13-29(41(44)45)21(33)15-23(19)35/h10-16,26-27H,4-9H2,1-3H3 |
| InChIKey | HQTWOUKJYYIPBM-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.50 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|