C17H25BF2N2O2 — CID 140776998
1-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-amine (PubChem CID 140776998) has the molecular formula C17H25BF2N2O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 1-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-amine.
| Compound Name | 1-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 140776998 |
| Molecular Formula | C17H25BF2N2O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-amine |
| SMILES | CC1(C)OB(c2cc(F)c(CN3CCC(N)C3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C17H25BF2N2O2/c1-16(2)17(3,4)24-18(23-16)11-7-14(19)13(15(20)8-11)10-22-6-5-12(21)9-22/h7-8,12H,5-6,9-10,21H2,1-4H3 |
| InChIKey | YGJSXHXUTLGTEZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|