C11H13F3N2 — CID 142326312
(3R)-1-[(2,3,6-trifluorophenyl)methyl]pyrrolidin-3-amine (PubChem CID 142326312) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is (3R)-1-[(2,3,6-trifluorophenyl)methyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[(2,3,6-trifluorophenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 142326312 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | (3R)-1-[(2,3,6-trifluorophenyl)methyl]pyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(Cc2c(F)ccc(F)c2F)C1 |
| InChI | InChI=1S/C11H13F3N2/c12-9-1-2-10(13)11(14)8(9)6-16-4-3-7(15)5-16/h1-2,7H,3-6,15H2/t7-/m1/s1 |
| InChIKey | IHGFUFPVWNOWNI-SSDOTTSWSA-N |
| XLogP | 1.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|