C13H18ClF2IN2 — CID 120843374
1-[1-[(2,6-difluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]ethanamine;hydrochloride (PubChem CID 120843374) has the molecular formula C13H18ClF2IN2 and a molecular weight of 402.65 g/mol. Its IUPAC name is 1-[1-[(2,6-difluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[(2,6-difluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120843374 |
| Molecular Formula | C13H18ClF2IN2 |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 1-[1-[(2,6-difluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCN(Cc2c(F)ccc(I)c2F)C1.Cl |
| InChI | InChI=1S/C13H17F2IN2.ClH/c1-8(17)9-4-5-18(6-9)7-10-11(14)2-3-12(16)13(10)15;/h2-3,8-9H,4-7,17H2,1H3;1H |
| InChIKey | WWSUNUSQQAHZQR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|