C12H16ClF2IN2O — CID 120844446
[4-[(2,6-difluoro-3-iodophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride (PubChem CID 120844446) has the molecular formula C12H16ClF2IN2O and a molecular weight of 404.63 g/mol. Its IUPAC name is [4-[(2,6-difluoro-3-iodophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride.
| Compound Name | [4-[(2,6-difluoro-3-iodophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120844446 |
| Molecular Formula | C12H16ClF2IN2O |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | [4-[(2,6-difluoro-3-iodophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CN(Cc2c(F)ccc(I)c2F)CCO1 |
| InChI | InChI=1S/C12H15F2IN2O.ClH/c13-10-1-2-11(15)12(14)9(10)7-17-3-4-18-8(5-16)6-17;/h1-2,8H,3-7,16H2;1H |
| InChIKey | RHVCVZSDSJSVEV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|