C10H18Cl2N2OS — CID 71432312
[4-(thiophen-2-ylmethyl)morpholin-2-yl]methanamine;dihydrochloride (PubChem CID 71432312) has the molecular formula C10H18Cl2N2OS and a molecular weight of 285.24 g/mol. Its IUPAC name is [4-(thiophen-2-ylmethyl)morpholin-2-yl]methanamine;dihydrochloride.
| Compound Name | [4-(thiophen-2-ylmethyl)morpholin-2-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 71432312 |
| Molecular Formula | C10H18Cl2N2OS |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | [4-(thiophen-2-ylmethyl)morpholin-2-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCC1CN(Cc2cccs2)CCO1 |
| InChI | InChI=1S/C10H16N2OS.2ClH/c11-6-9-7-12(3-4-13-9)8-10-2-1-5-14-10;;/h1-2,5,9H,3-4,6-8,11H2;2*1H |
| InChIKey | AZLWCCFAPBPJBQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |