C19H29BFNO2 — CID 169422720
1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methylpiperidine (PubChem CID 169422720) has the molecular formula C19H29BFNO2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methylpiperidine.
| Compound Name | 1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 169422720 |
| Molecular Formula | C19H29BFNO2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methylpiperidine |
| SMILES | CC1CCCN(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)C1 |
| InChI | InChI=1S/C19H29BFNO2/c1-14-7-6-10-22(12-14)13-15-8-9-16(11-17(15)21)20-23-18(2,3)19(4,5)24-20/h8-9,11,14H,6-7,10,12-13H2,1-5H3 |
| InChIKey | FPIWVMGKXDABEM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|