C18H27BFNO3 — CID 169422723
4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylmorpholine (PubChem CID 169422723) has the molecular formula C18H27BFNO3 and a molecular weight of 335.23 g/mol. Its IUPAC name is 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylmorpholine.
| Compound Name | 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylmorpholine |
|---|---|
| PubChem CID | 169422723 |
| Molecular Formula | C18H27BFNO3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylmorpholine |
| SMILES | CC1CN(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)CCO1 |
| InChI | InChI=1S/C18H27BFNO3/c1-13-11-21(8-9-22-13)12-14-6-7-15(10-16(14)20)19-23-17(2,3)18(4,5)24-19/h6-7,10,13H,8-9,11-12H2,1-5H3 |
| InChIKey | LIDCDPJSSJXADZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|