C14H20BNO5 — CID 68647351
2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid (PubChem CID 68647351) has the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. Its IUPAC name is 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid.
| Compound Name | 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 68647351 |
| Molecular Formula | C14H20BNO5 |
| Molecular Weight | 293.13 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid |
| SMILES | CCOc1ncc(B2OC(C)(C)C(C)(C)O2)cc1C(=O)O |
| InChI | InChI=1S/C14H20BNO5/c1-6-19-11-10(12(17)18)7-9(8-16-11)15-20-13(2,3)14(4,5)21-15/h7-8H,6H2,1-5H3,(H,17,18) |
| InChIKey | LHYIMGSNGBTNBV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.13 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|