C16H25BN2O3 — CID 168678105
2-methyl-N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (PubChem CID 168678105) has the molecular formula C16H25BN2O3 and a molecular weight of 304.20 g/mol. Its IUPAC name is 2-methyl-N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168678105 |
| Molecular Formula | C16H25BN2O3 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 2-methyl-N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cnc1C |
| InChI | InChI=1S/C16H25BN2O3/c1-7-8-18-14(20)13-9-12(10-19-11(13)2)17-21-15(3,4)16(5,6)22-17/h9-10H,7-8H2,1-6H3,(H,18,20) |
| InChIKey | VBSRLSNOJACMEG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|