C15H22BNO4S — CID 167506768
methyl 3-ethylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (PubChem CID 167506768) has the molecular formula C15H22BNO4S and a molecular weight of 323.22 g/mol. Its IUPAC name is methyl 3-ethylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate.
| Compound Name | methyl 3-ethylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 167506768 |
| Molecular Formula | C15H22BNO4S |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | methyl 3-ethylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| SMILES | CCSc1cc(B2OC(C)(C)C(C)(C)O2)cnc1C(=O)OC |
| InChI | InChI=1S/C15H22BNO4S/c1-7-22-11-8-10(9-17-12(11)13(18)19-6)16-20-14(2,3)15(4,5)21-16/h8-9H,7H2,1-6H3 |
| InChIKey | NGDHWZVHKVGGNB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|