C13H20BNO4S2 — CID 166555025
CID 166555025 (PubChem CID 166555025) has the molecular formula C13H20BNO4S2 and a molecular weight of 329.25 g/mol.
| Compound Name | CID 166555025 |
|---|---|
| PubChem CID | 166555025 |
| Molecular Formula | C13H20BNO4S2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1.SS |
| InChI | InChI=1S/C13H18BNO4.H2S2/c1-12(2)13(3,4)19-14(18-12)9-6-7-10(15-8-9)11(16)17-5;1-2/h6-8H,1-5H3;1-2H |
| InChIKey | MMYAKGVWXAOEKK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|