C14H22BN3O3 — CID 131552920
N-methyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]acetamide (PubChem CID 131552920) has the molecular formula C14H22BN3O3 and a molecular weight of 291.16 g/mol. Its IUPAC name is N-methyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]acetamide.
| Compound Name | N-methyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]acetamide |
|---|---|
| PubChem CID | 131552920 |
| Molecular Formula | C14H22BN3O3 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-methyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]acetamide |
| SMILES | CNC(=O)CNc1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C14H22BN3O3/c1-13(2)14(3,4)21-15(20-13)10-6-7-11(17-8-10)18-9-12(19)16-5/h6-8H,9H2,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | IRZPFUAOLYVIRX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|