C19H28BN3O4 — CID 155703049
(E)-4-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide (PubChem CID 155703049) has the molecular formula C19H28BN3O4 and a molecular weight of 373.26 g/mol. Its IUPAC name is (E)-4-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide.
| Compound Name | (E)-4-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 155703049 |
| Molecular Formula | C19H28BN3O4 |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (E)-4-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide |
| SMILES | CC1(C)OB(c2ccc(NC(=O)/C=C/CN3CCOCC3)nc2)OC1(C)C |
| InChI | InChI=1S/C19H28BN3O4/c1-18(2)19(3,4)27-20(26-18)15-7-8-16(21-14-15)22-17(24)6-5-9-23-10-12-25-13-11-23/h5-8,14H,9-13H2,1-4H3,(H,21,22,24)/b6-5+ |
| InChIKey | MKFADHDWZTURDA-AATRIKPKSA-N |
| XLogP | 1.21 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|