C19H28BN3O4 — CID 175196247
(E)-N-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide (PubChem CID 175196247) has the molecular formula C19H28BN3O4 and a molecular weight of 373.26 g/mol. Its IUPAC name is (E)-N-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide.
| Compound Name | (E)-N-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 175196247 |
| Molecular Formula | C19H28BN3O4 |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (E)-N-morpholin-4-yl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]but-2-enamide |
| SMILES | C/C=C/C(=O)N(c1ccc(B2OC(C)(C)C(C)(C)O2)cn1)N1CCOCC1 |
| InChI | InChI=1S/C19H28BN3O4/c1-6-7-17(24)23(22-10-12-25-13-11-22)16-9-8-15(14-21-16)20-26-18(2,3)19(4,5)27-20/h6-9,14H,10-13H2,1-5H3/b7-6+ |
| InChIKey | MHRHKLIAVKYFPY-VOTSOKGWSA-N |
| XLogP | 1.54 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|