C17H23BBrNO4 — CID 91820756
[2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 91820756) has the molecular formula C17H23BBrNO4 and a molecular weight of 396.09 g/mol. Its IUPAC name is [2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 91820756 |
| Molecular Formula | C17H23BBrNO4 |
| Molecular Weight | 396.09 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | CC1(C)OB(c2ccc(Br)c(C(=O)N3CCOCC3)c2)OC1(C)C |
| InChI | InChI=1S/C17H23BBrNO4/c1-16(2)17(3,4)24-18(23-16)12-5-6-14(19)13(11-12)15(21)20-7-9-22-10-8-20/h5-6,11H,7-10H2,1-4H3 |
| InChIKey | MTYNVGLNUOZFIL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.09 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|