C17H24BNO5 — CID 90095738
[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] morpholine-4-carboxylate (PubChem CID 90095738) has the molecular formula C17H24BNO5 and a molecular weight of 333.19 g/mol. Its IUPAC name is [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] morpholine-4-carboxylate.
| Compound Name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 90095738 |
| Molecular Formula | C17H24BNO5 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] morpholine-4-carboxylate |
| SMILES | CC1(C)OB(c2cccc(OC(=O)N3CCOCC3)c2)OC1(C)C |
| InChI | InChI=1S/C17H24BNO5/c1-16(2)17(3,4)24-18(23-16)13-6-5-7-14(12-13)22-15(20)19-8-10-21-11-9-19/h5-7,12H,8-11H2,1-4H3 |
| InChIKey | XLORTLDOCADLFQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|