C21H20N4O3 — CID 127036830
[3-(2-amino-6-phenylpyrimidin-4-yl)phenyl] morpholine-4-carboxylate (PubChem CID 127036830) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is [3-(2-amino-6-phenylpyrimidin-4-yl)phenyl] morpholine-4-carboxylate.
| Compound Name | [3-(2-amino-6-phenylpyrimidin-4-yl)phenyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 127036830 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [3-(2-amino-6-phenylpyrimidin-4-yl)phenyl] morpholine-4-carboxylate |
| SMILES | Nc1nc(-c2ccccc2)cc(-c2cccc(OC(=O)N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C21H20N4O3/c22-20-23-18(15-5-2-1-3-6-15)14-19(24-20)16-7-4-8-17(13-16)28-21(26)25-9-11-27-12-10-25/h1-8,13-14H,9-12H2,(H2,22,23,24) |
| InChIKey | VIBAFZDZRHJJRN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |