C18H24BN3O3 — CID 156726497
4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-yl]morpholine (PubChem CID 156726497) has the molecular formula C18H24BN3O3 and a molecular weight of 341.22 g/mol. Its IUPAC name is 4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-yl]morpholine.
| Compound Name | 4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-yl]morpholine |
|---|---|
| PubChem CID | 156726497 |
| Molecular Formula | C18H24BN3O3 |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-yl]morpholine |
| SMILES | CC1(C)OB(c2cnc3ccc(N4CCOCC4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C18H24BN3O3/c1-17(2)18(3,4)25-19(24-17)13-11-15-14(20-12-13)5-6-16(21-15)22-7-9-23-10-8-22/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | AWHNYJCLZSTJSQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|