C18H15F2N3O — CID 67035153
4-[7-(3,5-difluorophenyl)quinoxalin-2-yl]morpholine (PubChem CID 67035153) has the molecular formula C18H15F2N3O and a molecular weight of 327.33 g/mol. Its IUPAC name is 4-[7-(3,5-difluorophenyl)quinoxalin-2-yl]morpholine.
| Compound Name | 4-[7-(3,5-difluorophenyl)quinoxalin-2-yl]morpholine |
|---|---|
| PubChem CID | 67035153 |
| Molecular Formula | C18H15F2N3O |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-[7-(3,5-difluorophenyl)quinoxalin-2-yl]morpholine |
| SMILES | Fc1cc(F)cc(-c2ccc3ncc(N4CCOCC4)nc3c2)c1 |
| InChI | InChI=1S/C18H15F2N3O/c19-14-7-13(8-15(20)10-14)12-1-2-16-17(9-12)22-18(11-21-16)23-3-5-24-6-4-23/h1-2,7-11H,3-6H2 |
| InChIKey | FWNVZCLNMFFWJF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |