C28H24F3N3O2 — CID 153102403
1-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 153102403) has the molecular formula C28H24F3N3O2 and a molecular weight of 491.51 g/mol. Its IUPAC name is 1-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 153102403 |
| Molecular Formula | C28H24F3N3O2 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(-c2ccc3ncc(N4CCOCC4)nc3c2)cc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H24F3N3O2/c29-28(30,31)23-8-3-20(4-9-23)16-24(35)15-19-1-5-21(6-2-19)22-7-10-25-26(17-22)33-27(18-32-25)34-11-13-36-14-12-34/h1-10,17-18H,11-16H2 |
| InChIKey | VRIBCCHBIUXYQS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |