C34H34N6O — CID 157464006
1-[4-(dimethylamino)phenyl]-3-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]propan-2-one (PubChem CID 157464006) has the molecular formula C34H34N6O and a molecular weight of 542.69 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]propan-2-one.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 157464006 |
| Molecular Formula | C34H34N6O |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]propan-2-one |
| SMILES | CN(C)c1ccc(CC(=O)Cc2ccc(-c3ccc4ncc(N5CCN(c6ccncc6)CC5)nc4c3)cc2)cc1 |
| InChI | InChI=1S/C34H34N6O/c1-38(2)29-10-5-26(6-11-29)22-31(41)21-25-3-7-27(8-4-25)28-9-12-32-33(23-28)37-34(24-36-32)40-19-17-39(18-20-40)30-13-15-35-16-14-30/h3-16,23-24H,17-22H2,1-2H3 |
| InChIKey | BUGJZHHCGXPNAG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|