C31H27FN6O — CID 67035435
2-(4-fluorophenyl)-N-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]acetamide (PubChem CID 67035435) has the molecular formula C31H27FN6O and a molecular weight of 518.60 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 67035435 |
| Molecular Formula | C31H27FN6O |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ccc(-c2ccc3ncc(N4CCN(c5ccncc5)CC4)nc3c2)cc1 |
| InChI | InChI=1S/C31H27FN6O/c32-25-6-1-22(2-7-25)19-31(39)35-26-8-3-23(4-9-26)24-5-10-28-29(20-24)36-30(21-34-28)38-17-15-37(16-18-38)27-11-13-33-14-12-27/h1-14,20-21H,15-19H2,(H,35,39) |
| InChIKey | URHCQGKSMNRRDZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |