C26H25N5O2S — CID 88961637
N-[4-[3-(4-hydroxysulfanylpiperazin-1-yl)quinoxalin-6-yl]phenyl]-2-phenylacetamide (PubChem CID 88961637) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is N-[4-[3-(4-hydroxysulfanylpiperazin-1-yl)quinoxalin-6-yl]phenyl]-2-phenylacetamide.
| Compound Name | N-[4-[3-(4-hydroxysulfanylpiperazin-1-yl)quinoxalin-6-yl]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 88961637 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[4-[3-(4-hydroxysulfanylpiperazin-1-yl)quinoxalin-6-yl]phenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(-c2ccc3ncc(N4CCN(SO)CC4)nc3c2)cc1 |
| InChI | InChI=1S/C26H25N5O2S/c32-26(16-19-4-2-1-3-5-19)28-22-9-6-20(7-10-22)21-8-11-23-24(17-21)29-25(18-27-23)30-12-14-31(34-33)15-13-30/h1-11,17-18,33H,12-16H2,(H,28,32) |
| InChIKey | YVPXGKGFRYADDJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|