C27H29N7O — CID 67035131
N-[4-[3-(4-pyrazin-2-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]pentanamide (PubChem CID 67035131) has the molecular formula C27H29N7O and a molecular weight of 467.58 g/mol. Its IUPAC name is N-[4-[3-(4-pyrazin-2-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]pentanamide.
| Compound Name | N-[4-[3-(4-pyrazin-2-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 67035131 |
| Molecular Formula | C27H29N7O |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[4-[3-(4-pyrazin-2-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(-c2ccc3ncc(N4CCN(c5cnccn5)CC4)nc3c2)cc1 |
| InChI | InChI=1S/C27H29N7O/c1-2-3-4-27(35)31-22-8-5-20(6-9-22)21-7-10-23-24(17-21)32-26(19-30-23)34-15-13-33(14-16-34)25-18-28-11-12-29-25/h5-12,17-19H,2-4,13-16H2,1H3,(H,31,35) |
| InChIKey | RAGKUCMZASXKDF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |