C27H23F3N4O2 — CID 67035538
N-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 67035538) has the molecular formula C27H23F3N4O2 and a molecular weight of 492.50 g/mol. Its IUPAC name is N-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67035538 |
| Molecular Formula | C27H23F3N4O2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[4-(3-morpholin-4-ylquinoxalin-6-yl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)Nc1ccc(-c2ccc3ncc(N4CCOCC4)nc3c2)cc1 |
| InChI | InChI=1S/C27H23F3N4O2/c28-27(29,30)21-3-1-2-18(14-21)15-26(35)32-22-7-4-19(5-8-22)20-6-9-23-24(16-20)33-25(17-31-23)34-10-12-36-13-11-34/h1-9,14,16-17H,10-13,15H2,(H,32,35) |
| InChIKey | YCCFWEDKSNIGDJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |