C30H25FN6O — CID 140597681
N-[2-fluoro-4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]benzamide (PubChem CID 140597681) has the molecular formula C30H25FN6O and a molecular weight of 504.57 g/mol. Its IUPAC name is N-[2-fluoro-4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]benzamide.
| Compound Name | N-[2-fluoro-4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 140597681 |
| Molecular Formula | C30H25FN6O |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-[2-fluoro-4-[3-(4-pyridin-4-ylpiperazin-1-yl)quinoxalin-6-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2ccc3ncc(N4CCN(c5ccncc5)CC4)nc3c2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C30H25FN6O/c31-25-18-22(6-8-26(25)35-30(38)21-4-2-1-3-5-21)23-7-9-27-28(19-23)34-29(20-33-27)37-16-14-36(15-17-37)24-10-12-32-13-11-24/h1-13,18-20H,14-17H2,(H,35,38) |
| InChIKey | OJHNJSGWTQJAOD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |