C30H29N5O — CID 153148663
1-[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]hex-5-yn-2-one (PubChem CID 153148663) has the molecular formula C30H29N5O and a molecular weight of 475.60 g/mol. Its IUPAC name is 1-[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]hex-5-yn-2-one.
| Compound Name | 1-[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]hex-5-yn-2-one |
|---|---|
| PubChem CID | 153148663 |
| Molecular Formula | C30H29N5O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]hex-5-yn-2-one |
| SMILES | C#CCCC(=O)Cc1ccc(-c2ccc3ncc(N4CCN(Cc5cccnc5)CC4)nc3c2)cc1 |
| InChI | InChI=1S/C30H29N5O/c1-2-3-6-27(36)18-23-7-9-25(10-8-23)26-11-12-28-29(19-26)33-30(21-32-28)35-16-14-34(15-17-35)22-24-5-4-13-31-20-24/h1,4-5,7-13,19-21H,3,6,14-18,22H2 |
| InChIKey | WAAUFZJCCRVLLF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|