C18H19N5 — CID 33378276
2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxaline (PubChem CID 33378276) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxaline.
| Compound Name | 2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 33378276 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxaline |
| SMILES | c1cncc(CN2CCN(c3cnc4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C18H19N5/c1-2-6-17-16(5-1)20-13-18(21-17)23-10-8-22(9-11-23)14-15-4-3-7-19-12-15/h1-7,12-13H,8-11,14H2 |
| InChIKey | XLWJJZISEFZQIE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |