C19H18F3N5 — CID 171327302
2-[4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]quinoxaline (PubChem CID 171327302) has the molecular formula C19H18F3N5 and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]quinoxaline.
| Compound Name | 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 171327302 |
| Molecular Formula | C19H18F3N5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]quinoxaline |
| SMILES | FC(F)(F)c1ccc(CN2CCN(c3cnc4ccccc4n3)CC2)nc1 |
| InChI | InChI=1S/C19H18F3N5/c20-19(21,22)14-5-6-15(23-11-14)13-26-7-9-27(10-8-26)18-12-24-16-3-1-2-4-17(16)25-18/h1-6,11-12H,7-10,13H2 |
| InChIKey | BQRSLJAMVTWJIB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |