C17H18F4N4 — CID 171994100
1-[(5-fluoro-3-pyridinyl)methyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazine (PubChem CID 171994100) has the molecular formula C17H18F4N4 and a molecular weight of 354.35 g/mol. Its IUPAC name is 1-[(5-fluoro-3-pyridinyl)methyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazine.
| Compound Name | 1-[(5-fluoro-3-pyridinyl)methyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 171994100 |
| Molecular Formula | C17H18F4N4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[(5-fluoro-3-pyridinyl)methyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]methyl]piperazine |
| SMILES | Fc1cncc(CN2CCN(Cc3ccc(C(F)(F)F)cn3)CC2)c1 |
| InChI | InChI=1S/C17H18F4N4/c18-15-7-13(8-22-10-15)11-24-3-5-25(6-4-24)12-16-2-1-14(9-23-16)17(19,20)21/h1-2,7-10H,3-6,11-12H2 |
| InChIKey | BQTWVHBONAKINQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |