C10H13F2N3O2S — CID 154879461
4-[(5-fluoro-3-pyridinyl)methyl]piperazine-1-sulfonyl fluoride (PubChem CID 154879461) has the molecular formula C10H13F2N3O2S and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-[(5-fluoro-3-pyridinyl)methyl]piperazine-1-sulfonyl fluoride.
| Compound Name | 4-[(5-fluoro-3-pyridinyl)methyl]piperazine-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 154879461 |
| Molecular Formula | C10H13F2N3O2S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-[(5-fluoro-3-pyridinyl)methyl]piperazine-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)N1CCN(Cc2cncc(F)c2)CC1 |
| InChI | InChI=1S/C10H13F2N3O2S/c11-10-5-9(6-13-7-10)8-14-1-3-15(4-2-14)18(12,16)17/h5-7H,1-4,8H2 |
| InChIKey | LPUIDVXBYMHORV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |